About 6-methyl-3-propan-2-yl-1,2,4-triazine
6-methyl-3-propan-2-yl-1,2,4-triazine (PubChem CID 58126762) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 6-methyl-3-propan-2-yl-1,2,4-triazine.
Molecular Properties
| Compound Name | 6-methyl-3-propan-2-yl-1,2,4-triazine |
| PubChem CID | 58126762 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 6-methyl-3-propan-2-yl-1,2,4-triazine |
| SMILES | Cc1cnc(C(C)C)nn1 |
| InChI | InChI=1S/C7H11N3/c1-5(2)7-8-4-6(3)9-10-7/h4-5H,1-3H3 |
| InChIKey | MPCMDXGGWMZXAC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-3-propan-2-yl-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-propan-2-yl-1,2,4-triazine?
The IUPAC name of 6-methyl-3-propan-2-yl-1,2,4-triazine (CID 58126762) is 6-methyl-3-propan-2-yl-1,2,4-triazine.
What is the SMILES notation for 6-methyl-3-propan-2-yl-1,2,4-triazine?
The canonical SMILES for 6-methyl-3-propan-2-yl-1,2,4-triazine is Cc1cnc(C(C)C)nn1.
What is the InChIKey of 6-methyl-3-propan-2-yl-1,2,4-triazine?
The InChIKey is MPCMDXGGWMZXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-5(2)7-8-4-6(3)9-10-7/h4-5H,1-3H3.
What are the key properties of 6-methyl-3-propan-2-yl-1,2,4-triazine?
6-methyl-3-propan-2-yl-1,2,4-triazine has a molecular weight of 137.19 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-propan-2-yl-1,2,4-triazine is sourced from PubChem (CID 58126762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).