About 5-propan-2-yl-3H-pyridin-3-ide;rhodium
5-propan-2-yl-3H-pyridin-3-ide;rhodium (PubChem CID 58126788) has the molecular formula C8H10NRh-
and a molecular weight of 223.08 g/mol. Its IUPAC name is 5-propan-2-yl-3H-pyridin-3-ide;rhodium.
Molecular Properties
| Compound Name | 5-propan-2-yl-3H-pyridin-3-ide;rhodium |
| PubChem CID | 58126788 |
| Molecular Formula | C8H10NRh- |
| Molecular Weight | 223.08 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | 5-propan-2-yl-3H-pyridin-3-ide;rhodium |
| SMILES | CC(C)c1c[c-]cnc1.[Rh] |
| InChI | InChI=1S/C8H10N.Rh/c1-7(2)8-4-3-5-9-6-8;/h4-7H,1-2H3;/q-1; |
| InChIKey | CTBNONZNNULKPV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.08 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-propan-2-yl-3H-pyridin-3-ide;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-3H-pyridin-3-ide;rhodium?
The IUPAC name of 5-propan-2-yl-3H-pyridin-3-ide;rhodium (CID 58126788) is 5-propan-2-yl-3H-pyridin-3-ide;rhodium.
What is the SMILES notation for 5-propan-2-yl-3H-pyridin-3-ide;rhodium?
The canonical SMILES for 5-propan-2-yl-3H-pyridin-3-ide;rhodium is CC(C)c1c[c-]cnc1.[Rh].
What is the InChIKey of 5-propan-2-yl-3H-pyridin-3-ide;rhodium?
The InChIKey is CTBNONZNNULKPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N.Rh/c1-7(2)8-4-3-5-9-6-8;/h4-7H,1-2H3;/q-1;.
What are the key properties of 5-propan-2-yl-3H-pyridin-3-ide;rhodium?
5-propan-2-yl-3H-pyridin-3-ide;rhodium has a molecular weight of 223.08 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-3H-pyridin-3-ide;rhodium is sourced from PubChem (CID 58126788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).