C23H30ClN3O2 — CID 58127078
4-[[5-chloro-4-[6-(oxan-4-ylmethylamino)-2-pyridinyl]-2-pyridinyl]methyl]cyclohexan-1-ol (PubChem CID 58127078) has the molecular formula C23H30ClN3O2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 4-[[5-chloro-4-[6-(oxan-4-ylmethylamino)-2-pyridinyl]-2-pyridinyl]methyl]cyclohexan-1-ol.
| Compound Name | 4-[[5-chloro-4-[6-(oxan-4-ylmethylamino)-2-pyridinyl]-2-pyridinyl]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 58127078 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-[[5-chloro-4-[6-(oxan-4-ylmethylamino)-2-pyridinyl]-2-pyridinyl]methyl]cyclohexan-1-ol |
| SMILES | OC1CCC(Cc2cc(-c3cccc(NCC4CCOCC4)n3)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C23H30ClN3O2/c24-21-15-25-18(12-16-4-6-19(28)7-5-16)13-20(21)22-2-1-3-23(27-22)26-14-17-8-10-29-11-9-17/h1-3,13,15-17,19,28H,4-12,14H2,(H,26,27) |
| InChIKey | NZGQXOASOOYOTB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |