C14H24O4 — CID 58128334
(2S)-3,3-dimethyl-2-[2-(2-methylpent-4-enoxy)-2-oxoethyl]butanoic acid (PubChem CID 58128334) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[2-(2-methylpent-4-enoxy)-2-oxoethyl]butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-[2-(2-methylpent-4-enoxy)-2-oxoethyl]butanoic acid |
|---|---|
| PubChem CID | 58128334 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[2-(2-methylpent-4-enoxy)-2-oxoethyl]butanoic acid |
| SMILES | C=CCC(C)COC(=O)CC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H24O4/c1-6-7-10(2)9-18-12(15)8-11(13(16)17)14(3,4)5/h6,10-11H,1,7-9H2,2-5H3,(H,16,17) |
| InChIKey | KKIRITLGHIUNSV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|