C15H15ClF7N5 — CID 58128393
6-chloro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 58128393) has the molecular formula C15H15ClF7N5 and a molecular weight of 433.76 g/mol. Its IUPAC name is 6-chloro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-chloro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 58128393 |
| Molecular Formula | C15H15ClF7N5 |
| Molecular Weight | 433.76 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 6-chloro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1nc2ncnn2c(NC2CCC(C(F)(C(F)(F)F)C(F)(F)F)CC2)c1Cl |
| InChI | InChI=1S/C15H15ClF7N5/c1-7-10(16)11(28-12(26-7)24-6-25-28)27-9-4-2-8(3-5-9)13(17,14(18,19)20)15(21,22)23/h6,8-9,27H,2-5H2,1H3 |
| InChIKey | UJIZAQTVTUCFLM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.76 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |