C16H17ClF7N5 — CID 58128403
6-chloro-5-ethyl-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 58128403) has the molecular formula C16H17ClF7N5 and a molecular weight of 447.79 g/mol. Its IUPAC name is 6-chloro-5-ethyl-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-chloro-5-ethyl-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 58128403 |
| Molecular Formula | C16H17ClF7N5 |
| Molecular Weight | 447.79 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 6-chloro-5-ethyl-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCc1nc2ncnn2c(NC2CCC(C(F)(C(F)(F)F)C(F)(F)F)CC2)c1Cl |
| InChI | InChI=1S/C16H17ClF7N5/c1-2-10-11(17)12(29-13(28-10)25-7-26-29)27-9-5-3-8(4-6-9)14(18,15(19,20)21)16(22,23)24/h7-9,27H,2-6H2,1H3 |
| InChIKey | OBOJGPPUQYZHBO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.79 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |