About 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide
3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 58128730) has the molecular formula C7H12N2O2S
and a molecular weight of 188.25 g/mol. Its IUPAC name is 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide |
| PubChem CID | 58128730 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CC1C=CC(N)=CC1S(N)(=O)=O |
| InChI | InChI=1S/C7H12N2O2S/c1-5-2-3-6(8)4-7(5)12(9,10)11/h2-5,7H,8H2,1H3,(H2,9,10,11) |
| InChIKey | ANAMOPVZNFQRHU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide?
The IUPAC name of 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide (CID 58128730) is 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide.
What is the SMILES notation for 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide?
The canonical SMILES for 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide is CC1C=CC(N)=CC1S(N)(=O)=O.
What is the InChIKey of 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide?
The InChIKey is ANAMOPVZNFQRHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2S/c1-5-2-3-6(8)4-7(5)12(9,10)11/h2-5,7H,8H2,1H3,(H2,9,10,11).
What are the key properties of 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide?
3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide has a molecular weight of 188.25 g/mol, XLogP of -0.31, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide is sourced from PubChem (CID 58128730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).