C16H15FN4O2 — CID 58128753
1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-5-(1,2,4-triazol-1-yl)pentan-1-one (PubChem CID 58128753) has the molecular formula C16H15FN4O2 and a molecular weight of 314.32 g/mol. Its IUPAC name is 1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-5-(1,2,4-triazol-1-yl)pentan-1-one.
| Compound Name | 1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-5-(1,2,4-triazol-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 58128753 |
| Molecular Formula | C16H15FN4O2 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-5-(1,2,4-triazol-1-yl)pentan-1-one |
| SMILES | O=C(CCCCn1cncn1)c1cc(-c2ccc(F)cc2)on1 |
| InChI | InChI=1S/C16H15FN4O2/c17-13-6-4-12(5-7-13)16-9-14(20-23-16)15(22)3-1-2-8-21-11-18-10-19-21/h4-7,9-11H,1-3,8H2 |
| InChIKey | HHNMJDBOJOGYPO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|