About 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one
1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one (PubChem CID 58128762) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one.
Molecular Properties
| Compound Name | 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one |
| PubChem CID | 58128762 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one |
| SMILES | O=C(CCCOc1ccccn1)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C16H14N2O4/c19-13(5-3-10-21-16-7-1-2-8-17-16)12-11-15(22-18-12)14-6-4-9-20-14/h1-2,4,6-9,11H,3,5,10H2 |
| InChIKey | ZQLDPZJQEFPQKP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one?
The IUPAC name of 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one (CID 58128762) is 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one.
What is the SMILES notation for 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one?
The canonical SMILES for 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one is O=C(CCCOc1ccccn1)c1cc(-c2ccco2)on1.
What is the InChIKey of 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one?
The InChIKey is ZQLDPZJQEFPQKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4/c19-13(5-3-10-21-16-7-1-2-8-17-16)12-11-15(22-18-12)14-6-4-9-20-14/h1-2,4,6-9,11H,3,5,10H2.
What are the key properties of 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one?
1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one has a molecular weight of 298.30 g/mol, XLogP of 3.37, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(furan-2-yl)-1,2-oxazol-3-yl]-4-pyridin-2-yloxybutan-1-one is sourced from PubChem (CID 58128762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).