C32H56O7 — CID 58129550
(1R,3S,9S,11S,16R)-9-[(Z)-4-ethylhex-2-en-2-yl]-13-hydroxy-5-methoxy-3,6,11,14,14,18,18-heptamethyl-8,17,19-trioxabicyclo[14.3.0]nonadecane-7,15-dione (PubChem CID 58129550) has the molecular formula C32H56O7 and a molecular weight of 552.79 g/mol. Its IUPAC name is (1R,3S,9S,11S,16R)-9-[(Z)-4-ethylhex-2-en-2-yl]-13-hydroxy-5-methoxy-3,6,11,14,14,18,18-heptamethyl-8,17,19-trioxabicyclo[14.3.0]nonadecane-7,15-dione.
| Compound Name | (1R,3S,9S,11S,16R)-9-[(Z)-4-ethylhex-2-en-2-yl]-13-hydroxy-5-methoxy-3,6,11,14,14,18,18-heptamethyl-8,17,19-trioxabicyclo[14.3.0]nonadecane-7,15-dione |
|---|---|
| PubChem CID | 58129550 |
| Molecular Formula | C32H56O7 |
| Molecular Weight | 552.79 g/mol |
| Exact Mass | 552.40 |
| IUPAC Name | (1R,3S,9S,11S,16R)-9-[(Z)-4-ethylhex-2-en-2-yl]-13-hydroxy-5-methoxy-3,6,11,14,14,18,18-heptamethyl-8,17,19-trioxabicyclo[14.3.0]nonadecane-7,15-dione |
| SMILES | CCC(/C=C(/C)[C@@H]1C[C@@H](C)CC(O)C(C)(C)C(=O)[C@@H]2OC(C)(C)O[C@@H]2C[C@@H](C)CC(OC)C(C)C(=O)O1)CC |
| InChI | InChI=1S/C32H56O7/c1-12-23(13-2)18-21(5)24-14-20(4)17-27(33)31(7,8)29(34)28-26(38-32(9,10)39-28)16-19(3)15-25(36-11)22(6)30(35)37-24/h18-20,22-28,33H,12-17H2,1-11H3/b21-18-/t19-,20+,22?,24-,25?,26+,27?,28+/m0/s1 |
| InChIKey | OHFHCXGNBVJPBY-WYGFTHAGSA-N |
| XLogP | 6.25 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.79 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|