C55H63N3S7 — CID 58129788
4,7-bis[5-(7,7-dihexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine (PubChem CID 58129788) has the molecular formula C55H63N3S7 and a molecular weight of 990.60 g/mol. Its IUPAC name is 4,7-bis[5-(7,7-dihexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine.
| Compound Name | 4,7-bis[5-(7,7-dihexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 58129788 |
| Molecular Formula | C55H63N3S7 |
| Molecular Weight | 990.60 g/mol |
| Exact Mass | 989.31 |
| IUPAC Name | 4,7-bis[5-(7,7-dihexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)thiophen-2-yl]-[1,2,5]thiadiazolo[3,4-c]pyridine |
| SMILES | CCCCCCC1(CCCCCC)c2ccsc2-c2sc(-c3ccc(-c4cnc(-c5ccc(-c6cc7c(s6)-c6sccc6C7(CCCCCC)CCCCCC)s5)c5nsnc45)s3)cc21 |
| InChI | InChI=1S/C55H63N3S7/c1-5-9-13-17-27-54(28-18-14-10-6-2)37-25-31-59-50(37)52-39(54)33-45(63-52)42-22-21-41(61-42)36-35-56-48(49-47(36)57-65-58-49)44-24-23-43(62-44)46-34-40-53(64-46)51-38(26-32-60-51)55(40,29-19-15-11-7-3)30-20-16-12-8-4/h21-26,31-35H,5-20,27-30H2,1-4H3 |
| InChIKey | BHWFYWPRLCQZCX-UHFFFAOYSA-N |
| XLogP | 20.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.60 |
| LogP ≤ 5 | 20.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|