C24H35N7O3 — CID 58130000
4-amino-2-butoxy-7-[[6-[3-(4-methylpiperazin-1-yl)propoxy]-3-pyridinyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58130000) has the molecular formula C24H35N7O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 4-amino-2-butoxy-7-[[6-[3-(4-methylpiperazin-1-yl)propoxy]-3-pyridinyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-butoxy-7-[[6-[3-(4-methylpiperazin-1-yl)propoxy]-3-pyridinyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 58130000 |
| Molecular Formula | C24H35N7O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | 4-amino-2-butoxy-7-[[6-[3-(4-methylpiperazin-1-yl)propoxy]-3-pyridinyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1ccc(OCCCN3CCN(C)CC3)nc1)C(=O)C2 |
| InChI | InChI=1S/C24H35N7O3/c1-3-4-13-34-24-27-22(25)19-15-21(32)31(23(19)28-24)17-18-6-7-20(26-16-18)33-14-5-8-30-11-9-29(2)10-12-30/h6-7,16H,3-5,8-15,17H2,1-2H3,(H2,25,27,28) |
| InChIKey | UWOOFPCFNZEPHQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|