C22H30N6O4 — CID 58130028
4-amino-2-butoxy-7-[[6-(2-morpholin-4-ylethoxy)-3-pyridinyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 58130028) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-amino-2-butoxy-7-[[6-(2-morpholin-4-ylethoxy)-3-pyridinyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-butoxy-7-[[6-(2-morpholin-4-ylethoxy)-3-pyridinyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 58130028 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-amino-2-butoxy-7-[[6-(2-morpholin-4-ylethoxy)-3-pyridinyl]methyl]-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1ccc(OCCN3CCOCC3)nc1)C(=O)C2 |
| InChI | InChI=1S/C22H30N6O4/c1-2-3-9-32-22-25-20(23)17-13-19(29)28(21(17)26-22)15-16-4-5-18(24-14-16)31-12-8-27-6-10-30-11-7-27/h4-5,14H,2-3,6-13,15H2,1H3,(H2,23,25,26) |
| InChIKey | OODDRVLBSDGRQO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|