C38H30O10S2 — CID 58130359
4-[(4-oxo-3-phenylthiochromen-2-yl)methoxycarbonyloxy]butyl (1,1,4-trioxo-3-phenylthiochromen-2-yl)methyl carbonate (PubChem CID 58130359) has the molecular formula C38H30O10S2 and a molecular weight of 710.78 g/mol. Its IUPAC name is 4-[(4-oxo-3-phenylthiochromen-2-yl)methoxycarbonyloxy]butyl (1,1,4-trioxo-3-phenylthiochromen-2-yl)methyl carbonate.
| Compound Name | 4-[(4-oxo-3-phenylthiochromen-2-yl)methoxycarbonyloxy]butyl (1,1,4-trioxo-3-phenylthiochromen-2-yl)methyl carbonate |
|---|---|
| PubChem CID | 58130359 |
| Molecular Formula | C38H30O10S2 |
| Molecular Weight | 710.78 g/mol |
| Exact Mass | 710.13 |
| IUPAC Name | 4-[(4-oxo-3-phenylthiochromen-2-yl)methoxycarbonyloxy]butyl (1,1,4-trioxo-3-phenylthiochromen-2-yl)methyl carbonate |
| SMILES | O=C(OCCCCOC(=O)OCc1sc2ccccc2c(=O)c1-c1ccccc1)OCC1=C(c2ccccc2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C38H30O10S2/c39-35-27-17-7-9-19-29(27)49-30(33(35)25-13-3-1-4-14-25)23-47-37(41)45-21-11-12-22-46-38(42)48-24-32-34(26-15-5-2-6-16-26)36(40)28-18-8-10-20-31(28)50(32,43)44/h1-10,13-20H,11-12,21-24H2 |
| InChIKey | LGZZFNFRAGXEBG-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.78 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|