About 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene
3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene (PubChem CID 58130596) has the molecular formula C30H18S6
and a molecular weight of 570.88 g/mol. Its IUPAC name is 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene.
Molecular Properties
| Compound Name | 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene |
| PubChem CID | 58130596 |
| Molecular Formula | C30H18S6 |
| Molecular Weight | 570.88 g/mol |
| Exact Mass | 569.97 |
| IUPAC Name | 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene |
| SMILES | c1cc(-c2sccc2-c2cc(-c3ccsc3-c3ccsc3)cc(-c3ccsc3-c3ccsc3)c2)cs1 |
| InChI | InChI=1S/C30H18S6/c1-7-31-16-19(1)28-25(4-10-34-28)22-13-23(26-5-11-35-29(26)20-2-8-32-17-20)15-24(14-22)27-6-12-36-30(27)21-3-9-33-18-21/h1-18H |
| InChIKey | YDJAMQBDDVDUPC-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.88 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene?
The IUPAC name of 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene (CID 58130596) is 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene.
What is the SMILES notation for 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene?
The canonical SMILES for 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene is c1cc(-c2sccc2-c2cc(-c3ccsc3-c3ccsc3)cc(-c3ccsc3-c3ccsc3)c2)cs1.
What is the InChIKey of 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene?
The InChIKey is YDJAMQBDDVDUPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H18S6/c1-7-31-16-19(1)28-25(4-10-34-28)22-13-23(26-5-11-35-29(26)20-2-8-32-17-20)15-24(14-22)27-6-12-36-30(27)21-3-9-33-18-21/h1-18H.
What are the key properties of 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene?
3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene has a molecular weight of 570.88 g/mol, XLogP of 12.06, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(2-thiophen-3-ylthiophen-3-yl)phenyl]-2-thiophen-3-ylthiophene is sourced from PubChem (CID 58130596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).