About (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile
(8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile (PubChem CID 58130631) has the molecular formula C10H10BrNO2
and a molecular weight of 256.10 g/mol. Its IUPAC name is (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile.
Molecular Properties
| Compound Name | (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile |
| PubChem CID | 58130631 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile |
| SMILES | CC12CC3(C#N)CC1[C@H](Br)C(O2)C3=O |
| InChI | InChI=1S/C10H10BrNO2/c1-9-3-10(4-12)2-5(9)6(11)7(14-9)8(10)13/h5-7H,2-3H2,1H3/t5?,6-,7?,9?,10?/m0/s1 |
| InChIKey | ZPLBYYYOGGUXNS-GPIUKQIHSA-N |
| XLogP | 1.41 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile?
The IUPAC name of (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile (CID 58130631) is (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile.
What is the SMILES notation for (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile?
The canonical SMILES for (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile is CC12CC3(C#N)CC1[C@H](Br)C(O2)C3=O.
What is the InChIKey of (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile?
The InChIKey is ZPLBYYYOGGUXNS-GPIUKQIHSA-N. The full InChI is InChI=1S/C10H10BrNO2/c1-9-3-10(4-12)2-5(9)6(11)7(14-9)8(10)13/h5-7H,2-3H2,1H3/t5?,6-,7?,9?,10?/m0/s1.
What are the key properties of (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile?
(8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile has a molecular weight of 256.10 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-8-bromo-3-methyl-9-oxo-2-oxatricyclo[3.3.1.03,7]nonane-5-carbonitrile is sourced from PubChem (CID 58130631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).