C38H50N7O12S2 — CID 58130756
CID 58130756 (PubChem CID 58130756) has the molecular formula C38H50N7O12S2 and a molecular weight of 860.99 g/mol.
| Compound Name | CID 58130756 |
|---|---|
| PubChem CID | 58130756 |
| Molecular Formula | C38H50N7O12S2 |
| Molecular Weight | 860.99 g/mol |
| Exact Mass | 860.30 |
| IUPAC Name | — |
| SMILES | CSCC[C@@H]1NCC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NN[C@H](C(=O)C(=O)[C@H](CO)NC(=O)[C@@H]([NH])Cc2ccc(O)cc2)[C@@H](C)O)CSC1=O |
| InChI | InChI=1S/C38H50N7O12S2/c1-20(47)32(34(53)33(52)28(18-46)43-35(54)24(39)14-22-8-10-23(48)11-9-22)45-44-29-19-59-38(57)25(12-13-58-2)40-17-30(49)26(15-21-6-4-3-5-7-21)41-36(55)27(16-31(50)51)42-37(29)56/h3-11,20,24-29,32,39-40,44-48H,12-19H2,1-2H3,(H,41,55)(H,42,56)(H,43,54)(H,50,51)/t20-,24+,25+,26+,27+,28+,29+,32+/m1/s1 |
| InChIKey | FXDYWIWJJFPIKX-VOYJGBGOSA-N |
| XLogP | -2.35 |
| TPSA | 313.46 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.99 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|