C68H56F24Si5 — CID 58131215
bis[3,6-bis[[3,5-bis(trifluoromethyl)phenyl]-dimethylsilyl]-9H-fluoren-1-yl]-dimethylsilane (PubChem CID 58131215) has the molecular formula C68H56F24Si5 and a molecular weight of 1469.58 g/mol. Its IUPAC name is bis[3,6-bis[[3,5-bis(trifluoromethyl)phenyl]-dimethylsilyl]-9H-fluoren-1-yl]-dimethylsilane.
| Compound Name | bis[3,6-bis[[3,5-bis(trifluoromethyl)phenyl]-dimethylsilyl]-9H-fluoren-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 58131215 |
| Molecular Formula | C68H56F24Si5 |
| Molecular Weight | 1469.58 g/mol |
| Exact Mass | 1468.28 |
| IUPAC Name | bis[3,6-bis[[3,5-bis(trifluoromethyl)phenyl]-dimethylsilyl]-9H-fluoren-1-yl]-dimethylsilane |
| SMILES | C[Si](C)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc2c(c1)-c1cc([Si](C)(C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc([Si](C)(C)c3cc([Si](C)(C)c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc4c3Cc3ccc([Si](C)(C)c5cc(C(F)(F)F)cc(C(F)(F)F)c5)cc3-4)c1C2 |
| InChI | InChI=1S/C68H56F24Si5/c1-93(2,47-21-37(61(69,70)71)17-38(22-47)62(72,73)74)45-13-11-35-15-57-55(53(35)29-45)31-51(95(5,6)49-25-41(65(81,82)83)19-42(26-49)66(84,85)86)33-59(57)97(9,10)60-34-52(96(7,8)50-27-43(67(87,88)89)20-44(28-50)68(90,91)92)32-56-54-30-46(14-12-36(54)16-58(56)60)94(3,4)48-23-39(63(75,76)77)18-40(24-48)64(78,79)80/h11-14,17-34H,15-16H2,1-10H3 |
| InChIKey | CVAJYFULBZMGQJ-UHFFFAOYSA-N |
| XLogP | 17.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 97 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1469.58 |
| LogP ≤ 5 | 17.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|