About [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold
[4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold (PubChem CID 58131458) has the molecular formula C20H23AuN3O2S2-2
and a molecular weight of 598.52 g/mol. Its IUPAC name is [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold.
Molecular Properties
| Compound Name | [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold |
| PubChem CID | 58131458 |
| Molecular Formula | C20H23AuN3O2S2-2 |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold |
| SMILES | CN(C)c1ccc(OC(=O)c2ccc(N3CCN(C([S-])[S-])CC3)cc2)cc1.[Au] |
| InChI | InChI=1S/C20H25N3O2S2.Au/c1-21(2)16-7-9-18(10-8-16)25-19(24)15-3-5-17(6-4-15)22-11-13-23(14-12-22)20(26)27;/h3-10,20,26-27H,11-14H2,1-2H3;/p-2 |
| InChIKey | WTSXYCZHJGGIAZ-UHFFFAOYSA-L |
| XLogP | 2.47 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold?
The IUPAC name of [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold (CID 58131458) is [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold.
What is the SMILES notation for [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold?
The canonical SMILES for [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold is CN(C)c1ccc(OC(=O)c2ccc(N3CCN(C([S-])[S-])CC3)cc2)cc1.[Au].
What is the InChIKey of [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold?
The InChIKey is WTSXYCZHJGGIAZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H25N3O2S2.Au/c1-21(2)16-7-9-18(10-8-16)25-19(24)15-3-5-17(6-4-15)22-11-13-23(14-12-22)20(26)27;/h3-10,20,26-27H,11-14H2,1-2H3;/p-2.
What are the key properties of [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold?
[4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold has a molecular weight of 598.52 g/mol, XLogP of 2.47, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[4-(dimethylamino)phenoxy]carbonylphenyl]piperazin-1-yl]methanedithiolate;gold is sourced from PubChem (CID 58131458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).