C22H41NO5 — CID 58132182
cis-tert-butyl (1S,2R)-2-hydroxy-2,3,3,4,4,5,5-heptamethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate (PubChem CID 58132182) has the molecular formula C22H41NO5 and a molecular weight of 399.57 g/mol. Its IUPAC name is cis-tert-butyl (1S,2R)-2-hydroxy-2,3,3,4,4,5,5-heptamethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate.
| Compound Name | cis-tert-butyl (1S,2R)-2-hydroxy-2,3,3,4,4,5,5-heptamethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 58132182 |
| Molecular Formula | C22H41NO5 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | cis-tert-butyl (1S,2R)-2-hydroxy-2,3,3,4,4,5,5-heptamethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(C(=O)OC(C)(C)C)C(C)(C)C(C)(C)C(C)(C)[C@@]1(C)O |
| InChI | InChI=1S/C22H41NO5/c1-16(2,3)27-14(24)22(23-15(25)28-17(4,5)6)20(11,12)18(7,8)19(9,10)21(22,13)26/h26H,1-13H3,(H,23,25)/t21-,22+/m1/s1 |
| InChIKey | MFYOPJJKIVNBKR-YADHBBJMSA-N |
| XLogP | 4.43 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |