C30H24F2N2O3S — CID 58132255
2-(3-aminophenyl)sulfonyl-1-[3-(2-fluorophenyl)-1-[(2-fluorophenyl)methyl]-5-methylindol-2-yl]ethanone (PubChem CID 58132255) has the molecular formula C30H24F2N2O3S and a molecular weight of 530.60 g/mol. Its IUPAC name is 2-(3-aminophenyl)sulfonyl-1-[3-(2-fluorophenyl)-1-[(2-fluorophenyl)methyl]-5-methylindol-2-yl]ethanone.
| Compound Name | 2-(3-aminophenyl)sulfonyl-1-[3-(2-fluorophenyl)-1-[(2-fluorophenyl)methyl]-5-methylindol-2-yl]ethanone |
|---|---|
| PubChem CID | 58132255 |
| Molecular Formula | C30H24F2N2O3S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 2-(3-aminophenyl)sulfonyl-1-[3-(2-fluorophenyl)-1-[(2-fluorophenyl)methyl]-5-methylindol-2-yl]ethanone |
| SMILES | Cc1ccc2c(c1)c(-c1ccccc1F)c(C(=O)CS(=O)(=O)c1cccc(N)c1)n2Cc1ccccc1F |
| InChI | InChI=1S/C30H24F2N2O3S/c1-19-13-14-27-24(15-19)29(23-10-3-5-12-26(23)32)30(34(27)17-20-7-2-4-11-25(20)31)28(35)18-38(36,37)22-9-6-8-21(33)16-22/h2-16H,17-18,33H2,1H3 |
| InChIKey | VFIRHYGVYOFMCU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|