C23H16ClF3N2O4S — CID 58132480
5-chloro-N-methylsulfonyl-3-(6-oxocyclohexa-1,3-dien-1-yl)-1-[(2,3,4-trifluorophenyl)methyl]indole-2-carboxamide (PubChem CID 58132480) has the molecular formula C23H16ClF3N2O4S and a molecular weight of 508.91 g/mol. Its IUPAC name is 5-chloro-N-methylsulfonyl-3-(6-oxocyclohexa-1,3-dien-1-yl)-1-[(2,3,4-trifluorophenyl)methyl]indole-2-carboxamide.
| Compound Name | 5-chloro-N-methylsulfonyl-3-(6-oxocyclohexa-1,3-dien-1-yl)-1-[(2,3,4-trifluorophenyl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 58132480 |
| Molecular Formula | C23H16ClF3N2O4S |
| Molecular Weight | 508.91 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 5-chloro-N-methylsulfonyl-3-(6-oxocyclohexa-1,3-dien-1-yl)-1-[(2,3,4-trifluorophenyl)methyl]indole-2-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1c(C2=CC=CCC2=O)c2cc(Cl)ccc2n1Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C23H16ClF3N2O4S/c1-34(32,33)28-23(31)22-19(14-4-2-3-5-18(14)30)15-10-13(24)7-9-17(15)29(22)11-12-6-8-16(25)21(27)20(12)26/h2-4,6-10H,5,11H2,1H3,(H,28,31) |
| InChIKey | FGNWIXVGSWCNOM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|