About [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate
[(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate (PubChem CID 58133160) has the molecular formula C10H13N3O2
and a molecular weight of 207.23 g/mol. Its IUPAC name is [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate.
Molecular Properties
| Compound Name | [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate |
| PubChem CID | 58133160 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate |
| SMILES | N#C/N=C/O[C@H]1CCC[C@H](CN=C=O)C1 |
| InChI | InChI=1S/C10H13N3O2/c11-6-13-8-15-10-3-1-2-9(4-10)5-12-7-14/h8-10H,1-5H2/b13-8+/t9-,10-/m0/s1 |
| InChIKey | AJUASDWBPVJMMC-ZFRLMCFGSA-N |
| XLogP | 1.41 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate?
The IUPAC name of [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate (CID 58133160) is [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate.
What is the SMILES notation for [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate?
The canonical SMILES for [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate is N#C/N=C/O[C@H]1CCC[C@H](CN=C=O)C1.
What is the InChIKey of [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate?
The InChIKey is AJUASDWBPVJMMC-ZFRLMCFGSA-N. The full InChI is InChI=1S/C10H13N3O2/c11-6-13-8-15-10-3-1-2-9(4-10)5-12-7-14/h8-10H,1-5H2/b13-8+/t9-,10-/m0/s1.
What are the key properties of [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate?
[(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate has a molecular weight of 207.23 g/mol, XLogP of 1.41, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3S)-3-(isocyanatomethyl)cyclohexyl] N-cyanomethanimidate is sourced from PubChem (CID 58133160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).