C20H25N3O6 — CID 58133300
[(2R,3S,5R)-5-ethyl-4-methyl-2-(5-nitroindol-1-yl)oxolan-3-yl] 4-(methylamino)-4-oxobutanoate (PubChem CID 58133300) has the molecular formula C20H25N3O6 and a molecular weight of 403.44 g/mol. Its IUPAC name is [(2R,3S,5R)-5-ethyl-4-methyl-2-(5-nitroindol-1-yl)oxolan-3-yl] 4-(methylamino)-4-oxobutanoate.
| Compound Name | [(2R,3S,5R)-5-ethyl-4-methyl-2-(5-nitroindol-1-yl)oxolan-3-yl] 4-(methylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 58133300 |
| Molecular Formula | C20H25N3O6 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | [(2R,3S,5R)-5-ethyl-4-methyl-2-(5-nitroindol-1-yl)oxolan-3-yl] 4-(methylamino)-4-oxobutanoate |
| SMILES | CC[C@H]1O[C@@H](n2ccc3cc([N+](=O)[O-])ccc32)[C@@H](OC(=O)CCC(=O)NC)C1C |
| InChI | InChI=1S/C20H25N3O6/c1-4-16-12(2)19(29-18(25)8-7-17(24)21-3)20(28-16)22-10-9-13-11-14(23(26)27)5-6-15(13)22/h5-6,9-12,16,19-20H,4,7-8H2,1-3H3,(H,21,24)/t12?,16-,19+,20-/m1/s1 |
| InChIKey | RHCZXOZGLOPCBN-MPDJGHSHSA-N |
| XLogP | 2.93 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|