C54H42N10O2Ru2-2 — CID 58133348
2,5-bis(3H-pyrrol-2-yl)benzene-1,4-diolate;tetrakis(2-pyridin-2-ylpyridine);ruthenium (PubChem CID 58133348) has the molecular formula C54H42N10O2Ru2-2 and a molecular weight of 1065.14 g/mol. Its IUPAC name is 2,5-bis(3H-pyrrol-2-yl)benzene-1,4-diolate;tetrakis(2-pyridin-2-ylpyridine);ruthenium.
| Compound Name | 2,5-bis(3H-pyrrol-2-yl)benzene-1,4-diolate;tetrakis(2-pyridin-2-ylpyridine);ruthenium |
|---|---|
| PubChem CID | 58133348 |
| Molecular Formula | C54H42N10O2Ru2-2 |
| Molecular Weight | 1065.14 g/mol |
| Exact Mass | 1066.16 |
| IUPAC Name | 2,5-bis(3H-pyrrol-2-yl)benzene-1,4-diolate;tetrakis(2-pyridin-2-ylpyridine);ruthenium |
| SMILES | [O-]c1cc(C2=NC=CC2)c([O-])cc1C1=NC=CC1.[Ru].[Ru].c1ccc(-c2ccccn2)nc1.c1ccc(-c2ccccn2)nc1.c1ccc(-c2ccccn2)nc1.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C14H12N2O2.4C10H8N2.2Ru/c17-13-8-10(12-4-2-6-16-12)14(18)7-9(13)11-3-1-5-15-11;4*1-3-7-11-9(5-1)10-6-2-4-8-12-10;;/h1-2,5-8,17-18H,3-4H2;4*1-8H;;/p-2 |
| InChIKey | RQEQNOPVSXVAKI-UHFFFAOYSA-L |
| XLogP | 9.82 |
| TPSA | 173.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.14 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |