C16H12BrClF2N2O3 — CID 58133375
methyl 5-bromo-2-[[2-(2-chloro-3,6-difluorophenyl)acetyl]-methylamino]pyridine-3-carboxylate (PubChem CID 58133375) has the molecular formula C16H12BrClF2N2O3 and a molecular weight of 433.64 g/mol. Its IUPAC name is methyl 5-bromo-2-[[2-(2-chloro-3,6-difluorophenyl)acetyl]-methylamino]pyridine-3-carboxylate.
| Compound Name | methyl 5-bromo-2-[[2-(2-chloro-3,6-difluorophenyl)acetyl]-methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 58133375 |
| Molecular Formula | C16H12BrClF2N2O3 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 431.97 |
| IUPAC Name | methyl 5-bromo-2-[[2-(2-chloro-3,6-difluorophenyl)acetyl]-methylamino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(Br)cnc1N(C)C(=O)Cc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C16H12BrClF2N2O3/c1-22(15-10(16(24)25-2)5-8(17)7-21-15)13(23)6-9-11(19)3-4-12(20)14(9)18/h3-5,7H,6H2,1-2H3 |
| InChIKey | NFHBIMUCFAYLBO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|