C32H38F2O5Si — CID 58133473
4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[difluoro(phenyl)methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 58133473) has the molecular formula C32H38F2O5Si and a molecular weight of 568.73 g/mol. Its IUPAC name is 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[difluoro(phenyl)methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[difluoro(phenyl)methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 58133473 |
| Molecular Formula | C32H38F2O5Si |
| Molecular Weight | 568.73 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[difluoro(phenyl)methyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CC1(C)OC2C(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC(C(F)(F)c3ccccc3)C(O)C2O1 |
| InChI | InChI=1S/C32H38F2O5Si/c1-30(2,3)40(23-17-11-7-12-18-23,24-19-13-8-14-20-24)36-21-25-27-28(39-31(4,5)38-27)26(35)29(37-25)32(33,34)22-15-9-6-10-16-22/h6-20,25-29,35H,21H2,1-5H3 |
| InChIKey | OJUQQZCREFZOJK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|