C20H22F2O5 — CID 58133509
(2R,3R,4S,5S,6R)-2-[(2-benzylphenyl)-difluoromethyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 58133509) has the molecular formula C20H22F2O5 and a molecular weight of 380.39 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(2-benzylphenyl)-difluoromethyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(2-benzylphenyl)-difluoromethyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58133509 |
| Molecular Formula | C20H22F2O5 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2-benzylphenyl)-difluoromethyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](C(F)(F)c2ccccc2Cc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H22F2O5/c21-20(22,19-18(26)17(25)16(24)15(11-23)27-19)14-9-5-4-8-13(14)10-12-6-2-1-3-7-12/h1-9,15-19,23-26H,10-11H2/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | GSYHEJSOINZMJD-UJWQCDCRSA-N |
| XLogP | 1.21 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |