C21H24F2O6 — CID 58133562
(2R,3R,4S,5S,6R)-2-[difluoro-[2-[(4-methylphenyl)methyl]phenyl]methyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 58133562) has the molecular formula C21H24F2O6 and a molecular weight of 410.41 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[difluoro-[2-[(4-methylphenyl)methyl]phenyl]methyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[difluoro-[2-[(4-methylphenyl)methyl]phenyl]methyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 58133562 |
| Molecular Formula | C21H24F2O6 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[difluoro-[2-[(4-methylphenyl)methyl]phenyl]methyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | Cc1ccc(Cc2ccccc2C(F)(F)[C@]2(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C21H24F2O6/c1-12-6-8-13(9-7-12)10-14-4-2-3-5-15(14)20(22,23)21(28)19(27)18(26)17(25)16(11-24)29-21/h2-9,16-19,24-28H,10-11H2,1H3/t16-,17-,18+,19-,21-/m1/s1 |
| InChIKey | HWECWTWDXMGLBM-GQUPQBGVSA-N |
| XLogP | 0.84 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |