About 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid
4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 58134110) has the molecular formula C15H20N2O6
and a molecular weight of 324.33 g/mol. Its IUPAC name is 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid |
| PubChem CID | 58134110 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | CC(C)[C@@H](N)C(=O)OCCOCn1c(C(=O)O)cc2occc21 |
| InChI | InChI=1S/C15H20N2O6/c1-9(2)13(16)15(20)23-6-5-21-8-17-10-3-4-22-12(10)7-11(17)14(18)19/h3-4,7,9,13H,5-6,8,16H2,1-2H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | RHNQVOKTNRLUDI-CYBMUJFWSA-N |
| XLogP | 1.43 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid (CID 58134110) is 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid is CC(C)[C@@H](N)C(=O)OCCOCn1c(C(=O)O)cc2occc21.
What is the InChIKey of 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is RHNQVOKTNRLUDI-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H20N2O6/c1-9(2)13(16)15(20)23-6-5-21-8-17-10-3-4-22-12(10)7-11(17)14(18)19/h3-4,7,9,13H,5-6,8,16H2,1-2H3,(H,18,19)/t13-/m1/s1.
What are the key properties of 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid?
4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 324.33 g/mol, XLogP of 1.43, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(2R)-2-amino-3-methylbutanoyl]oxyethoxymethyl]furo[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 58134110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).