C18H16F2N2O6 — CID 58134654
ethyl 7,8-difluoro-6-nitro-4-oxospiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5(14),6,8-tetraene-13,1'-cyclobutane]-3-carboxylate (PubChem CID 58134654) has the molecular formula C18H16F2N2O6 and a molecular weight of 394.33 g/mol. Its IUPAC name is ethyl 7,8-difluoro-6-nitro-4-oxospiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5(14),6,8-tetraene-13,1'-cyclobutane]-3-carboxylate.
| Compound Name | ethyl 7,8-difluoro-6-nitro-4-oxospiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5(14),6,8-tetraene-13,1'-cyclobutane]-3-carboxylate |
|---|---|
| PubChem CID | 58134654 |
| Molecular Formula | C18H16F2N2O6 |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | ethyl 7,8-difluoro-6-nitro-4-oxospiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5(14),6,8-tetraene-13,1'-cyclobutane]-3-carboxylate |
| SMILES | CCOC(=O)c1cn2c3c(c(F)c(F)c([N+](=O)[O-])c3c1=O)OCCC21CCC1 |
| InChI | InChI=1S/C18H16F2N2O6/c1-2-27-17(24)9-8-21-14-10(15(9)23)13(22(25)26)11(19)12(20)16(14)28-7-6-18(21)4-3-5-18/h8H,2-7H2,1H3 |
| InChIKey | MOFRVDJAKDRMAO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|