C19H20F2N2O4 — CID 58134665
ethyl 6-amino-7,8-difluoro-11-methyl-4-oxospiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carboxylate (PubChem CID 58134665) has the molecular formula C19H20F2N2O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is ethyl 6-amino-7,8-difluoro-11-methyl-4-oxospiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carboxylate.
| Compound Name | ethyl 6-amino-7,8-difluoro-11-methyl-4-oxospiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carboxylate |
|---|---|
| PubChem CID | 58134665 |
| Molecular Formula | C19H20F2N2O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | ethyl 6-amino-7,8-difluoro-11-methyl-4-oxospiro[10-oxa-1-azatricyclo[7.4.1.05,14]tetradeca-2,5,7,9(14)-tetraene-13,1'-cyclobutane]-3-carboxylate |
| SMILES | CCOC(=O)c1cn2c3c(c(F)c(F)c(N)c3c1=O)OC(C)CC21CCC1 |
| InChI | InChI=1S/C19H20F2N2O4/c1-3-26-18(25)10-8-23-15-11(16(10)24)14(22)12(20)13(21)17(15)27-9(2)7-19(23)5-4-6-19/h8-9H,3-7,22H2,1-2H3 |
| InChIKey | JJDQPEDKEXSACX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|