C12H12BrClN2O — CID 58134955
(3aS,6aS)-3-bromo-5-[(4-chlorophenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole (PubChem CID 58134955) has the molecular formula C12H12BrClN2O and a molecular weight of 315.60 g/mol. Its IUPAC name is (3aS,6aS)-3-bromo-5-[(4-chlorophenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole.
| Compound Name | (3aS,6aS)-3-bromo-5-[(4-chlorophenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole |
|---|---|
| PubChem CID | 58134955 |
| Molecular Formula | C12H12BrClN2O |
| Molecular Weight | 315.60 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | (3aS,6aS)-3-bromo-5-[(4-chlorophenyl)methyl]-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazole |
| SMILES | Clc1ccc(CN2C[C@@H]3C(Br)=NO[C@@H]3C2)cc1 |
| InChI | InChI=1S/C12H12BrClN2O/c13-12-10-6-16(7-11(10)17-15-12)5-8-1-3-9(14)4-2-8/h1-4,10-11H,5-7H2/t10-,11+/m0/s1 |
| InChIKey | BHMDJKQSPYCCSU-WDEREUQCSA-N |
| XLogP | 2.88 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |