C17H26N2O3 — CID 58135011
tert-butyl (7R,13R)-13-methyl-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4-carboxylate (PubChem CID 58135011) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl (7R,13R)-13-methyl-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4-carboxylate.
| Compound Name | tert-butyl (7R,13R)-13-methyl-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4-carboxylate |
|---|---|
| PubChem CID | 58135011 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl (7R,13R)-13-methyl-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4-carboxylate |
| SMILES | C[C@@H]1CCC2C=C[C@H]3CCN(C(=O)OC(C)(C)C)C3C(=O)N21 |
| InChI | InChI=1S/C17H26N2O3/c1-11-5-7-13-8-6-12-9-10-18(14(12)15(20)19(11)13)16(21)22-17(2,3)4/h6,8,11-14H,5,7,9-10H2,1-4H3/t11-,12+,13?,14?/m1/s1 |
| InChIKey | CBRJVHJDVQSONY-KBHBFKLGSA-N |
| XLogP | 2.56 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|