C18H28N2O3 — CID 58135017
tert-butyl (7R,13R)-13-ethyl-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4-carboxylate (PubChem CID 58135017) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl (7R,13R)-13-ethyl-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4-carboxylate.
| Compound Name | tert-butyl (7R,13R)-13-ethyl-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4-carboxylate |
|---|---|
| PubChem CID | 58135017 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | tert-butyl (7R,13R)-13-ethyl-2-oxo-1,4-diazatricyclo[8.3.0.03,7]tridec-8-ene-4-carboxylate |
| SMILES | CC[C@@H]1CCC2C=C[C@H]3CCN(C(=O)OC(C)(C)C)C3C(=O)N21 |
| InChI | InChI=1S/C18H28N2O3/c1-5-13-8-9-14-7-6-12-10-11-19(15(12)16(21)20(13)14)17(22)23-18(2,3)4/h6-7,12-15H,5,8-11H2,1-4H3/t12-,13+,14?,15?/m0/s1 |
| InChIKey | ZYXHYODRTJTPTO-ZUJMUWTESA-N |
| XLogP | 2.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|