C30H41N5O3 — CID 58135134
2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(1-ethyl-7-methyl-2-oxo-3,4-dihydroquinolin-6-yl)amino]-N-pentylacetamide (PubChem CID 58135134) has the molecular formula C30H41N5O3 and a molecular weight of 519.69 g/mol. Its IUPAC name is 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(1-ethyl-7-methyl-2-oxo-3,4-dihydroquinolin-6-yl)amino]-N-pentylacetamide.
| Compound Name | 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(1-ethyl-7-methyl-2-oxo-3,4-dihydroquinolin-6-yl)amino]-N-pentylacetamide |
|---|---|
| PubChem CID | 58135134 |
| Molecular Formula | C30H41N5O3 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | 2-[[2-[1,3-dihydroisoindol-2-yl(methyl)amino]-2-oxoethyl]-(1-ethyl-7-methyl-2-oxo-3,4-dihydroquinolin-6-yl)amino]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN(CC(=O)N(C)N1Cc2ccccc2C1)c1cc2c(cc1C)N(CC)C(=O)CC2 |
| InChI | InChI=1S/C30H41N5O3/c1-5-7-10-15-31-28(36)20-33(21-30(38)32(4)34-18-24-11-8-9-12-25(24)19-34)26-17-23-13-14-29(37)35(6-2)27(23)16-22(26)3/h8-9,11-12,16-17H,5-7,10,13-15,18-21H2,1-4H3,(H,31,36) |
| InChIKey | YRCZBTLZWDFRPN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|