C29H38N4O2 — CID 58135443
2-(5-isocyano-2-methyl-N-[2-[methyl-(5-methyl-2,3-dihydro-1H-inden-2-yl)amino]-2-oxoethyl]anilino)-N-(4-methylpentyl)acetamide (PubChem CID 58135443) has the molecular formula C29H38N4O2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 2-(5-isocyano-2-methyl-N-[2-[methyl-(5-methyl-2,3-dihydro-1H-inden-2-yl)amino]-2-oxoethyl]anilino)-N-(4-methylpentyl)acetamide.
| Compound Name | 2-(5-isocyano-2-methyl-N-[2-[methyl-(5-methyl-2,3-dihydro-1H-inden-2-yl)amino]-2-oxoethyl]anilino)-N-(4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 58135443 |
| Molecular Formula | C29H38N4O2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 2-(5-isocyano-2-methyl-N-[2-[methyl-(5-methyl-2,3-dihydro-1H-inden-2-yl)amino]-2-oxoethyl]anilino)-N-(4-methylpentyl)acetamide |
| SMILES | [C-]#[N+]c1ccc(C)c(N(CC(=O)NCCCC(C)C)CC(=O)N(C)C2Cc3ccc(C)cc3C2)c1 |
| InChI | InChI=1S/C29H38N4O2/c1-20(2)8-7-13-31-28(34)18-33(27-17-25(30-5)12-10-22(27)4)19-29(35)32(6)26-15-23-11-9-21(3)14-24(23)16-26/h9-12,14,17,20,26H,7-8,13,15-16,18-19H2,1-4,6H3,(H,31,34) |
| InChIKey | ARMAMIOTSLDIMW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|