C22H28F2N4O2 — CID 58135550
(2S)-2-[2-[3-(2,4-difluorophenyl)-7-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide (PubChem CID 58135550) has the molecular formula C22H28F2N4O2 and a molecular weight of 418.49 g/mol. Its IUPAC name is (2S)-2-[2-[3-(2,4-difluorophenyl)-7-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[2-[3-(2,4-difluorophenyl)-7-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 58135550 |
| Molecular Formula | C22H28F2N4O2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | (2S)-2-[2-[3-(2,4-difluorophenyl)-7-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccc(F)cc2F)n2c1CN(C)CC2)C(C)(C)C |
| InChI | InChI=1S/C22H28F2N4O2/c1-22(2,3)15(21(30)25-4)11-18(29)19-17-12-27(5)8-9-28(17)20(26-19)14-7-6-13(23)10-16(14)24/h6-7,10,15H,8-9,11-12H2,1-5H3,(H,25,30)/t15-/m1/s1 |
| InChIKey | YGIFXHXONOTCLS-OAHLLOKOSA-N |
| XLogP | 3.25 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |