C24H31F3N4O2 — CID 58135553
(2R)-N,4,4-trimethyl-2-[2-[8-methyl-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]pentanamide (PubChem CID 58135553) has the molecular formula C24H31F3N4O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is (2R)-N,4,4-trimethyl-2-[2-[8-methyl-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]pentanamide.
| Compound Name | (2R)-N,4,4-trimethyl-2-[2-[8-methyl-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 58135553 |
| Molecular Formula | C24H31F3N4O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (2R)-N,4,4-trimethyl-2-[2-[8-methyl-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]pentanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2cc(F)c(F)cc2F)n2c1CN(C)CCC2)CC(C)(C)C |
| InChI | InChI=1S/C24H31F3N4O2/c1-24(2,3)12-14(23(33)28-4)9-20(32)21-19-13-30(5)7-6-8-31(19)22(29-21)15-10-17(26)18(27)11-16(15)25/h10-11,14H,6-9,12-13H2,1-5H3,(H,28,33)/t14-/m0/s1 |
| InChIKey | SUXOPXFZAAYULQ-AWEZNQCLSA-N |
| XLogP | 4.17 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|