C25H32F4N4O2 — CID 58135565
(2R)-2-[2-[3-[2-fluoro-4-(trifluoromethyl)phenyl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,4,4-trimethylpentanamide (PubChem CID 58135565) has the molecular formula C25H32F4N4O2 and a molecular weight of 496.55 g/mol. Its IUPAC name is (2R)-2-[2-[3-[2-fluoro-4-(trifluoromethyl)phenyl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,4,4-trimethylpentanamide.
| Compound Name | (2R)-2-[2-[3-[2-fluoro-4-(trifluoromethyl)phenyl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 58135565 |
| Molecular Formula | C25H32F4N4O2 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | (2R)-2-[2-[3-[2-fluoro-4-(trifluoromethyl)phenyl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,4,4-trimethylpentanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccc(C(F)(F)F)cc2F)n2c1CN(C)CCC2)CC(C)(C)C |
| InChI | InChI=1S/C25H32F4N4O2/c1-24(2,3)13-15(23(35)30-4)11-20(34)21-19-14-32(5)9-6-10-33(19)22(31-21)17-8-7-16(12-18(17)26)25(27,28)29/h7-8,12,15H,6,9-11,13-14H2,1-5H3,(H,30,35)/t15-/m0/s1 |
| InChIKey | VURRIAGXNFNRFN-HNNXBMFYSA-N |
| XLogP | 4.91 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |