C24H32F2N4O2 — CID 58135567
(2S)-2-[2-[3-(2,4-difluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,N,3,3-tetramethylbutanamide (PubChem CID 58135567) has the molecular formula C24H32F2N4O2 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2S)-2-[2-[3-(2,4-difluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,N,3,3-tetramethylbutanamide.
| Compound Name | (2S)-2-[2-[3-(2,4-difluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,N,3,3-tetramethylbutanamide |
|---|---|
| PubChem CID | 58135567 |
| Molecular Formula | C24H32F2N4O2 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (2S)-2-[2-[3-(2,4-difluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,N,3,3-tetramethylbutanamide |
| SMILES | CN1CCCn2c(-c3ccc(F)cc3F)nc(C(=O)C[C@H](C(=O)N(C)C)C(C)(C)C)c2C1 |
| InChI | InChI=1S/C24H32F2N4O2/c1-24(2,3)17(23(32)28(4)5)13-20(31)21-19-14-29(6)10-7-11-30(19)22(27-21)16-9-8-15(25)12-18(16)26/h8-9,12,17H,7,10-11,13-14H2,1-6H3/t17-/m1/s1 |
| InChIKey | NQBYUJHILYUXGK-QGZVFWFLSA-N |
| XLogP | 3.99 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |