C23H30F2N4O2 — CID 58135570
(2R)-2-[2-[3-(2,4-difluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,4-dimethylpentanamide (PubChem CID 58135570) has the molecular formula C23H30F2N4O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is (2R)-2-[2-[3-(2,4-difluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,4-dimethylpentanamide.
| Compound Name | (2R)-2-[2-[3-(2,4-difluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 58135570 |
| Molecular Formula | C23H30F2N4O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (2R)-2-[2-[3-(2,4-difluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,4-dimethylpentanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccc(F)cc2F)n2c1CN(C)CCC2)CC(C)C |
| InChI | InChI=1S/C23H30F2N4O2/c1-14(2)10-15(23(31)26-3)11-20(30)21-19-13-28(4)8-5-9-29(19)22(27-21)17-7-6-16(24)12-18(17)25/h6-7,12,14-15H,5,8-11,13H2,1-4H3,(H,26,31)/t15-/m1/s1 |
| InChIKey | JKRWZXBTIBGEHG-OAHLLOKOSA-N |
| XLogP | 3.64 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |