C22H27F3N4O2 — CID 58135588
(2S)-N,3,3-trimethyl-2-[2-oxo-2-[3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]ethyl]butanamide (PubChem CID 58135588) has the molecular formula C22H27F3N4O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is (2S)-N,3,3-trimethyl-2-[2-oxo-2-[3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]ethyl]butanamide.
| Compound Name | (2S)-N,3,3-trimethyl-2-[2-oxo-2-[3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 58135588 |
| Molecular Formula | C22H27F3N4O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (2S)-N,3,3-trimethyl-2-[2-oxo-2-[3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]ethyl]butanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2cccc(C(F)(F)F)c2)n2c1CNCC2)C(C)(C)C |
| InChI | InChI=1S/C22H27F3N4O2/c1-21(2,3)15(20(31)26-4)11-17(30)18-16-12-27-8-9-29(16)19(28-18)13-6-5-7-14(10-13)22(23,24)25/h5-7,10,15,27H,8-9,11-12H2,1-4H3,(H,26,31)/t15-/m1/s1 |
| InChIKey | NNYLIDHBQQCCKE-OAHLLOKOSA-N |
| XLogP | 3.65 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |