C29H36N4O2 — CID 58135592
(2S)-N,3,3-trimethyl-2-[2-[8-methyl-3-(2-phenylphenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]butanamide (PubChem CID 58135592) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is (2S)-N,3,3-trimethyl-2-[2-[8-methyl-3-(2-phenylphenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]butanamide.
| Compound Name | (2S)-N,3,3-trimethyl-2-[2-[8-methyl-3-(2-phenylphenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 58135592 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (2S)-N,3,3-trimethyl-2-[2-[8-methyl-3-(2-phenylphenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]butanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccccc2-c2ccccc2)n2c1CN(C)CCC2)C(C)(C)C |
| InChI | InChI=1S/C29H36N4O2/c1-29(2,3)23(28(35)30-4)18-25(34)26-24-19-32(5)16-11-17-33(24)27(31-26)22-15-10-9-14-21(22)20-12-7-6-8-13-20/h6-10,12-15,23H,11,16-19H2,1-5H3,(H,30,35)/t23-/m1/s1 |
| InChIKey | FUTSJNSXTBYGPN-HSZRJFAPSA-N |
| XLogP | 5.03 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |