C23H31FN4O2 — CID 58135597
(2S)-2-[2-[3-(2-fluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide (PubChem CID 58135597) has the molecular formula C23H31FN4O2 and a molecular weight of 414.53 g/mol. Its IUPAC name is (2S)-2-[2-[3-(2-fluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[2-[3-(2-fluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 58135597 |
| Molecular Formula | C23H31FN4O2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (2S)-2-[2-[3-(2-fluorophenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccccc2F)n2c1CN(C)CCC2)C(C)(C)C |
| InChI | InChI=1S/C23H31FN4O2/c1-23(2,3)16(22(30)25-4)13-19(29)20-18-14-27(5)11-8-12-28(18)21(26-20)15-9-6-7-10-17(15)24/h6-7,9-10,16H,8,11-14H2,1-5H3,(H,25,30)/t16-/m1/s1 |
| InChIKey | MTFDNBNQPRKMMG-MRXNPFEDSA-N |
| XLogP | 3.51 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |