C24H33FN4O2 — CID 58135602
(2S)-2-[2-[3-(4-fluoro-3-methylphenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide (PubChem CID 58135602) has the molecular formula C24H33FN4O2 and a molecular weight of 428.55 g/mol. Its IUPAC name is (2S)-2-[2-[3-(4-fluoro-3-methylphenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[2-[3-(4-fluoro-3-methylphenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 58135602 |
| Molecular Formula | C24H33FN4O2 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | (2S)-2-[2-[3-(4-fluoro-3-methylphenyl)-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccc(F)c(C)c2)n2c1CN(C)CCC2)C(C)(C)C |
| InChI | InChI=1S/C24H33FN4O2/c1-15-12-16(8-9-18(15)25)22-27-21(19-14-28(6)10-7-11-29(19)22)20(30)13-17(23(31)26-5)24(2,3)4/h8-9,12,17H,7,10-11,13-14H2,1-6H3,(H,26,31)/t17-/m1/s1 |
| InChIKey | OTIAMEMWUWTHLE-QGZVFWFLSA-N |
| XLogP | 3.81 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |