C21H27FN4O2 — CID 58135731
(2S)-2-[2-[3-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide (PubChem CID 58135731) has the molecular formula C21H27FN4O2 and a molecular weight of 386.47 g/mol. Its IUPAC name is (2S)-2-[2-[3-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[2-[3-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 58135731 |
| Molecular Formula | C21H27FN4O2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (2S)-2-[2-[3-(4-fluorophenyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazin-1-yl]-2-oxoethyl]-N,3,3-trimethylbutanamide |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccc(F)cc2)n2c1CNCC2)C(C)(C)C |
| InChI | InChI=1S/C21H27FN4O2/c1-21(2,3)15(20(28)23-4)11-17(27)18-16-12-24-9-10-26(16)19(25-18)13-5-7-14(22)8-6-13/h5-8,15,24H,9-12H2,1-4H3,(H,23,28)/t15-/m1/s1 |
| InChIKey | XRRKNYKQHOFALY-OAHLLOKOSA-N |
| XLogP | 2.77 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |