C29H34N4O4 — CID 58135739
tert-butyl 1-[(3S)-4-(methylamino)-4-oxo-3-phenylbutanoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate (PubChem CID 58135739) has the molecular formula C29H34N4O4 and a molecular weight of 502.62 g/mol. Its IUPAC name is tert-butyl 1-[(3S)-4-(methylamino)-4-oxo-3-phenylbutanoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate.
| Compound Name | tert-butyl 1-[(3S)-4-(methylamino)-4-oxo-3-phenylbutanoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate |
|---|---|
| PubChem CID | 58135739 |
| Molecular Formula | C29H34N4O4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | tert-butyl 1-[(3S)-4-(methylamino)-4-oxo-3-phenylbutanoyl]-3-phenyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-8-carboxylate |
| SMILES | CNC(=O)[C@@H](CC(=O)c1nc(-c2ccccc2)n2c1CN(C(=O)OC(C)(C)C)CCC2)c1ccccc1 |
| InChI | InChI=1S/C29H34N4O4/c1-29(2,3)37-28(36)32-16-11-17-33-23(19-32)25(31-26(33)21-14-9-6-10-15-21)24(34)18-22(27(35)30-4)20-12-7-5-8-13-20/h5-10,12-15,22H,11,16-19H2,1-4H3,(H,30,35)/t22-/m0/s1 |
| InChIKey | JRELCNASLMCOJQ-QFIPXVFZSA-N |
| XLogP | 4.79 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |