About [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate
[2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate (PubChem CID 58135823) has the molecular formula C17H32N4O3
and a molecular weight of 340.47 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate.
Molecular Properties
| Compound Name | [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate |
| PubChem CID | 58135823 |
| Molecular Formula | C17H32N4O3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate |
| SMILES | CN1CCC(C)(N2CCN(CC(=O)OCC(=O)N(C)C)CC2)CC1 |
| InChI | InChI=1S/C17H32N4O3/c1-17(5-7-19(4)8-6-17)21-11-9-20(10-12-21)13-16(23)24-14-15(22)18(2)3/h5-14H2,1-4H3 |
| InChIKey | AYENHKQIRLUYRE-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate?
The IUPAC name of [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate (CID 58135823) is [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate.
What is the SMILES notation for [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate?
The canonical SMILES for [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate is CN1CCC(C)(N2CCN(CC(=O)OCC(=O)N(C)C)CC2)CC1.
What is the InChIKey of [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate?
The InChIKey is AYENHKQIRLUYRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N4O3/c1-17(5-7-19(4)8-6-17)21-11-9-20(10-12-21)13-16(23)24-14-15(22)18(2)3/h5-14H2,1-4H3.
What are the key properties of [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate?
[2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate has a molecular weight of 340.47 g/mol, XLogP of -0.28, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dimethylamino)-2-oxoethyl] 2-[4-(1,4-dimethylpiperidin-4-yl)piperazin-1-yl]acetate is sourced from PubChem (CID 58135823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).