C16H32N4O2 — CID 58135977
3-(dimethylamino)propyl 2-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]acetate (PubChem CID 58135977) has the molecular formula C16H32N4O2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 2-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]acetate.
| Compound Name | 3-(dimethylamino)propyl 2-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 58135977 |
| Molecular Formula | C16H32N4O2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 3-(dimethylamino)propyl 2-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]acetate |
| SMILES | CN(C)CCCOC(=O)CN1CCC(N2CCN(C)CC2)C1 |
| InChI | InChI=1S/C16H32N4O2/c1-17(2)6-4-12-22-16(21)14-19-7-5-15(13-19)20-10-8-18(3)9-11-20/h15H,4-14H2,1-3H3 |
| InChIKey | NSAMPAZJAOYSAD-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|